ChemNet > CAS > 3564-73-6 10,11-Dihydrocarbamazepine
3564-73-6 10,11-Dihydrocarbamazepine
| product Name |
10,11-Dihydrocarbamazepine |
| CAS No |
3564-73-6 |
| Synonyms |
10,11-Dihydro-5H-dibenz[b,f]azepine-5-carboxamide; 10,11-dihydro-5H-dibenzo[b,f]azepine-5-carboxamide |
| Molecular Formula |
C15H14N2O |
| Molecular Weight |
238.2845 |
| InChI |
InChI=1/C15H14N2O/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17/h1-8H,9-10H2,(H2,16,18) |
| EINECS |
222-649-0 |
| Molecular Structure |
|
| Density |
1.232g/cm3 |
| Melting point |
205-210℃ |
| Boiling point |
394.5°C at 760 mmHg |
| Refractive index |
1.645 |
| Flash point |
192.4°C |
| Vapour Pressur |
1.96E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
